## the index structure for redwood. interacts with ferret.
-require 'thread'
require 'fileutils'
require 'ferret'
-#require_gem 'ferret', ">= 0.10.13"
+begin
+ require 'chronic'
+ $have_chronic = true
+rescue LoadError => e
+ Redwood::log "optional 'chronic' library not found (run 'gem install chronic' to install)"
+ $have_chronic = false
+end
module Redwood
class Index
+ class LockError < StandardError
+ def initialize h
+ @h = h
+ end
+
+ def method_missing m; @h[m.to_s] end
+ end
+
include Singleton
attr_reader :index
+ alias ferret index
def initialize dir=BASE_DIR
@dir = dir
@sources = {}
@sources_dirty = false
wsa = Ferret::Analysis::WhiteSpaceAnalyzer.new false
- sa = Ferret::Analysis::StandardAnalyzer.new Ferret::Analysis::FULL_ENGLISH_STOP_WORDS, true
+ sa = Ferret::Analysis::StandardAnalyzer.new [], true
@analyzer = Ferret::Analysis::PerFieldAnalyzer.new wsa
@analyzer[:body] = sa
- @qparser ||= Ferret::QueryParser.new :default_field => :body, :analyzer => @analyzer
+ @analyzer[:subject] = sa
+ @qparser ||= Ferret::QueryParser.new :default_field => :body, :analyzer => @analyzer, :or_default => false
+ @lock = Lockfile.new lockfile, :retries => 0, :max_age => nil
self.class.i_am_the_instance self
end
+ def lockfile; File.join @dir, "lock" end
+
+ def lock
+ Redwood::log "locking #{lockfile}..."
+ begin
+ @lock.lock
+ rescue Lockfile::MaxTriesLockError
+ raise LockError, @lock.lockinfo_on_disk
+ end
+ end
+
+ def start_lock_update_thread
+ @lock_update_thread = Redwood::reporting_thread("lock update") do
+ while true
+ sleep 30
+ @lock.touch_yourself
+ end
+ end
+ end
+
+ def stop_lock_update_thread
+ @lock_update_thread.kill if @lock_update_thread
+ @lock_update_thread = nil
+ end
+
+ def fancy_lock_error_message_for e
+ secs = Time.now - e.mtime
+ mins = secs.to_i / 60
+ time =
+ if mins == 0
+ "#{secs.to_i} seconds"
+ else
+ "#{mins} minutes"
+ end
+
+ <<EOS
+Error: the sup index is locked by another process! User '#{e.user}' on
+host '#{e.host}' is running #{e.pname} with pid #{e.pid}. The process was alive
+as of #{time} ago.
+EOS
+ end
+
+ def lock_or_die
+ begin
+ lock
+ rescue LockError => e
+ $stderr.puts fancy_lock_error_message_for(e)
+ $stderr.puts <<EOS
+
+You can wait for the process to finish, or, if it crashed and left a
+stale lock file behind, you can manually delete #{@lock.path}.
+EOS
+ exit
+ end
+ end
+
+ def unlock
+ if @lock && @lock.locked?
+ Redwood::log "unlocking #{lockfile}..."
+ @lock.unlock
+ end
+ end
+
def load
load_sources
load_index
end
def save
+ Redwood::log "saving index and sources..."
FileUtils.mkdir_p @dir unless File.exists? @dir
save_sources
save_index
def add_source source
raise "duplicate source!" if @sources.include? source
@sources_dirty = true
- source.id ||= @sources.size
- ##TODO: why was this necessary?
+ max = @sources.max_of { |id, s| s.is_a?(DraftLoader) || s.is_a?(SentLoader) ? 0 : id }
+ source.id ||= (max || 0) + 1
##source.id += 1 while @sources.member? source.id
@sources[source.id] = source
end
- def source_for uri; @sources.values.find { |s| s.is_source_for? uri }; end
- def usual_sources; @sources.values.find_all { |s| s.usual? }; end
- def sources; @sources.values; end
+ def sources
+ ## favour the inbox by listing non-archived sources first
+ @sources.values.sort_by { |s| s.id }.partition { |s| !s.archived? }.flatten
+ end
+
+ def source_for uri; sources.find { |s| s.is_source_for? uri }; end
+ def usual_sources; sources.find_all { |s| s.usual? }; end
def load_index dir=File.join(@dir, "ferret")
if File.exists? dir
end
end
- ## update the message by deleting and re-adding
- def update_message m, source=nil, source_info=nil
- docid, entry = load_entry_for_id m.id
- if entry
- source ||= entry[:source_id].to_i
- source_info ||= entry[:source_info].to_i
- end
+ ## Syncs the message to the index: deleting if it's already there,
+ ## and adding either way. Index state will be determined by m.labels.
+ ##
+ ## docid and entry can be specified if they're already known.
+ def sync_message m, docid=nil, entry=nil
+ docid, entry = load_entry_for_id m.id unless docid && entry
+
+ raise "no source info for message #{m.id}" unless m.source && m.source_info
+ raise "trying to delete non-corresponding entry #{docid} with index message-id #{@index[docid][:message_id].inspect} and parameter message id #{m.id.inspect}" if docid && @index[docid][:message_id] != m.id
+
+ source_id =
+ if m.source.is_a? Integer
+ m.source
+ else
+ m.source.id or raise "unregistered source #{m.source} (id #{m.source.id.inspect})"
+ end
+
+ to = (m.to + m.cc + m.bcc).map { |x| x.email }.join(" ")
+ snippet =
+ if m.snippet_contains_encrypted_content? && $config[:discard_snippets_from_encrypted_messages]
+ ""
+ else
+ m.snippet
+ end
- ## this happens sometimes. i'm not sure why. ferret bug?
- raise "no entry and no source info for message #{m.id}: source #{source.inspect}, info #{source_info.inspect}, entry #{entry.inspect}, query #{Ferret::Search::TermQuery.new(:message_id, m.id)}, results #{@index.search(Ferret::Search::TermQuery.new(:message_id, m.id)).inspect}" unless source && source_info
+ d = {
+ :message_id => m.id,
+ :source_id => source_id,
+ :source_info => m.source_info,
+ :date => m.date.to_indexable_s,
+ :body => m.indexable_content,
+ :snippet => snippet,
+ :label => m.labels.uniq.join(" "),
+ :from => m.from ? m.from.indexable_content : "",
+ :to => (m.to + m.cc + m.bcc).map { |x| x.indexable_content }.join(" "),
+ :subject => wrap_subj(m.subj),
+ :refs => (m.refs + m.replytos).uniq.join(" "),
+ }
- raise "deleting non-corresponding entry #{docid}" unless @index[docid][:message_id] == m.id
- @index.delete docid
- add_message m
+ @index.delete docid if docid
+ @index.add_document d
+
+ docid, entry = load_entry_for_id m.id
+ ## this hasn't been triggered in a long time. TODO: decide whether it's still a problem.
+ raise "just added message #{m.id.inspect} but couldn't find it in a search" unless docid
+ true
end
def save_index fn=File.join(@dir, "ferret")
- # don't have to do anything apparently
+ # don't have to do anything, apparently
end
def contains_id? id
def size; @index.size; end
## you should probably not call this on a block that doesn't break
- ## rather quickly because the results will probably be, as we say
- ## in scotland, frikkin' huuuge.
+ ## rather quickly because the results can be very large.
EACH_BY_DATE_NUM = 100
def each_id_by_date opts={}
return if @index.size == 0 # otherwise ferret barfs ###TODO: remove this once my ferret patch is accepted
def num_results_for opts={}
return 0 if @index.size == 0 # otherwise ferret barfs ###TODO: remove this once my ferret patch is accepted
+
q = build_query opts
- index.search(q).total_hits
+ index.search(q, :limit => 1).total_hits
end
## yield all messages in the thread containing 'm' by repeatedly
- ## querying the index. yields pairs of message ids and
+ ## querying the index. yields pairs of message ids and
## message-building lambdas, so that building an unwanted message
## can be skipped in the block if desired.
+ ##
+ ## only two options, :limit and :skip_killed. if :skip_killed is
+ ## true, stops loading any thread if a message with a :killed flag
+ ## is found.
SAME_SUBJECT_DATE_LIMIT = 7
+ MAX_CLAUSES = 1000
def each_message_in_thread_for m, opts={}
+ #Redwood::log "Building thread for #{m.id}: #{m.subj}"
messages = {}
searched = {}
num_queries = 0
- ## temporarily disabling subject searching because it's a
- ## significant slowdown.
- ##
- ## TODO: make this configurable, i guess
- if true
+ if $config[:thread_by_subject] # do subject queries
date_min = m.date - (SAME_SUBJECT_DATE_LIMIT * 12 * 3600)
date_max = m.date + (SAME_SUBJECT_DATE_LIMIT * 12 * 3600)
sq.add_term t
end
q.add_query sq, :must
- q.add_query Ferret::Search::TermQuery.new(:label, "spam"), :must_not
q.add_query Ferret::Search::RangeQuery.new(:date, :>= => date_min.to_indexable_s, :<= => date_max.to_indexable_s), :must
+ q = build_query :qobj => q
+
pending = @index.search(q).hits.map { |hit| @index[hit.doc][:message_id] }
Redwood::log "found #{pending.size} results for subject query #{q}"
else
end
until pending.empty? || (opts[:limit] && messages.size >= opts[:limit])
- id = pending.pop
- next if searched.member? id
- searched[id] = true
q = Ferret::Search::BooleanQuery.new true
- q.add_query Ferret::Search::TermQuery.new(:message_id, id), :should
- q.add_query Ferret::Search::TermQuery.new(:refs, id), :should
+ # this disappeared in newer ferrets... wtf.
+ # q.max_clause_count = 2048
+
+ lim = [MAX_CLAUSES / 2, pending.length].min
+ pending[0 ... lim].each do |id|
+ searched[id] = true
+ q.add_query Ferret::Search::TermQuery.new(:message_id, id), :should
+ q.add_query Ferret::Search::TermQuery.new(:refs, id), :should
+ end
+ pending = pending[lim .. -1]
+
+ q = build_query :qobj => q
num_queries += 1
+ killed = false
@index.search_each(q, :limit => :all) do |docid, score|
break if opts[:limit] && messages.size >= opts[:limit]
+ if @index[docid][:label].split(/\s+/).include?("killed") && opts[:skip_killed]
+ killed = true
+ break
+ end
mid = @index[docid][:message_id]
- unless messages.member? mid
+ unless messages.member?(mid)
+ #Redwood::log "got #{mid} as a child of #{id}"
messages[mid] ||= lambda { build_message docid }
refs = @index[docid][:refs].split(" ")
- pending += refs
+ pending += refs.select { |id| !searched[id] }
end
end
end
- Redwood::log "ran #{num_queries} queries to build thread of #{messages.size} messages for #{m.id}"
- messages.each { |mid, builder| yield mid, builder }
+
+ if killed
+ Redwood::log "thread for #{m.id} is killed, ignoring"
+ false
+ else
+ Redwood::log "ran #{num_queries} queries to build thread of #{messages.size + 1} messages for #{m.id}: #{m.subj}" if num_queries > 0
+ messages.each { |mid, builder| yield mid, builder }
+ true
+ end
end
## builds a message object from a ferret result
"date" => Time.at(doc[:date].to_i),
"subject" => unwrap_subj(doc[:subject]),
"from" => doc[:from],
- "to" => doc[:to],
+ "to" => doc[:to].split(/\s+/).join(", "), # reformat
"message-id" => doc[:message_id],
- "references" => doc[:refs],
+ "references" => doc[:refs].split(/\s+/).map { |x| "<#{x}>" }.join(" "),
}
Message.new :source => source, :source_info => doc[:source_info].to_i,
def wrap_subj subj; "__START_SUBJECT__ #{subj} __END_SUBJECT__"; end
def unwrap_subj subj; subj =~ /__START_SUBJECT__ (.*?) __END_SUBJECT__/ && $1; end
- def add_message m
- return false if contains? m
-
- source_id =
- if m.source.is_a? Integer
- m.source
- else
- m.source.id or raise "unregistered source #{m.source} (id #{m.source.id.inspect})"
- end
-
- to = (m.to + m.cc + m.bcc).map { |x| x.email }.join(" ")
- d = {
- :message_id => m.id,
- :source_id => source_id,
- :source_info => m.source_info,
- :date => m.date.to_indexable_s,
- :body => m.content,
- :snippet => m.snippet,
- :label => m.labels.join(" "),
- :from => m.from ? m.from.email : "",
- :to => (m.to + m.cc + m.bcc).map { |x| x.email }.join(" "),
- :subject => wrap_subj(Message.normalize_subj(m.subj)),
- :refs => (m.refs + m.replytos).uniq.join(" "),
- }
-
- @index.add_document d
-
- ## TODO: figure out why this is sometimes triggered
- docid, entry = load_entry_for_id m.id
- raise "just added message #{m.id} but couldn't find it in a search" unless docid
- true
- end
-
def drop_entry docno; @index.delete docno; end
def load_entry_for_id mid
num = h[:num] || 20
@index.search_each(q, :sort => "date DESC", :limit => :all) do |docid, score|
break if contacts.size >= num
- #Redwood::log "got message with to: #{@index[docid][:to].inspect} and from: #{@index[docid][:from].inspect}"
+ #Redwood::log "got message #{docid} to: #{@index[docid][:to].inspect} and from: #{@index[docid][:from].inspect}"
f = @index[docid][:from]
t = @index[docid][:to]
if AccountManager.is_account_email? f
- t.split(" ").each { |e| #Redwood::log "adding #{e} because there's a message to him from account email #{f}";
- contacts[Person.for(e)] = true }
+ t.split(" ").each { |e| contacts[PersonManager.person_for(e)] = true }
else
- #Redwood::log "adding from #{f} because there's a message from him to #{t}"
- contacts[Person.for(f)] = true
+ contacts[PersonManager.person_for(f)] = true
end
end
contacts.keys.compact
end
+ def load_sources fn=Redwood::SOURCE_FN
+ source_array = (Redwood::load_yaml_obj(fn) || []).map { |o| Recoverable.new o }
+ @sources = Hash[*(source_array).map { |s| [s.id, s] }.flatten]
+ @sources_dirty = false
+ end
+
+ def has_any_from_source_with_label? source, label
+ q = Ferret::Search::BooleanQuery.new
+ q.add_query Ferret::Search::TermQuery.new("source_id", source.id.to_s), :must
+ q.add_query Ferret::Search::TermQuery.new("label", label.to_s), :must
+ index.search(q, :limit => 1).total_hits > 0
+ end
+
protected
- def parse_user_query_string str; @qparser.parse str; end
+ ## do any specialized parsing
+ ## returns nil and flashes error message if parsing failed
+ def parse_user_query_string s
+ extraopts = {}
+
+ ## this is a little hacky, but it works, at least until ferret changes
+ ## its api. we parse the user query string with ferret twice: the first
+ ## time we just turn the resulting object back into a string, which has
+ ## the next effect of transforming the original string into a nice
+ ## normalized form with + and - instead of AND, OR, etc. then we do some
+ ## string substitutions which depend on this normalized form, re-parse
+ ## the string with Ferret, and return the resulting query object.
+
+ norms = @qparser.parse(s).to_s
+ Redwood::log "normalized #{s.inspect} to #{norms.inspect}" unless s == norms
+
+ subs = norms.gsub(/\b(to|from):(\S+)\b/) do
+ field, name = $1, $2
+ if(p = ContactManager.contact_for(name))
+ [field, p.email]
+ elsif name == "me"
+ [field, "(" + AccountManager.user_emails.join("||") + ")"]
+ else
+ [field, name]
+ end.join(":")
+ end
+
+ ## if we see a label:deleted or a label:spam term anywhere in the query
+ ## string, we set the extra load_spam or load_deleted options to true.
+ ## bizarre? well, because the query allows arbitrary parenthesized boolean
+ ## expressions, without fully parsing the query, we can't tell whether
+ ## the user is explicitly directing us to search spam messages or not.
+ ## e.g. if the string is -(-(-(-(-label:spam)))), does the user want to
+ ## search spam messages or not?
+ ##
+ ## so, we rely on the fact that turning these extra options ON turns OFF
+ ## the adding of "-label:deleted" or "-label:spam" terms at the very
+ ## final stage of query processing. if the user wants to search spam
+ ## messages, not adding that is the right thing; if he doesn't want to
+ ## search spam messages, then not adding it won't have any effect.
+ extraopts[:load_spam] = true if subs =~ /\blabel:spam\b/
+ extraopts[:load_deleted] = true if subs =~ /\blabel:deleted\b/
+
+ ## gmail style "is" operator
+ subs = subs.gsub(/\b(is):(\S+)\b/) do
+ field, label = $1, $2
+ case label
+ when "read"
+ "-label:unread"
+ when "spam"
+ extraopts[:load_spam] = true
+ "label:spam"
+ when "deleted"
+ extraopts[:load_deleted] = true
+ "label:deleted"
+ else
+ "label:#{$2}"
+ end
+ end
+
+ if $have_chronic
+ chronic_failure = false
+ subs = subs.gsub(/\b(before|on|in|during|after):(\((.+?)\)\B|(\S+)\b)/) do
+ break if chronic_failure
+ field, datestr = $1, ($3 || $4)
+ realdate = Chronic.parse(datestr, :guess => false, :context => :none)
+ if realdate
+ case field
+ when "after"
+ Redwood::log "chronic: translated #{field}:#{datestr} to #{realdate.end}"
+ "date:(>= #{sprintf "%012d", realdate.end.to_i})"
+ when "before"
+ Redwood::log "chronic: translated #{field}:#{datestr} to #{realdate.begin}"
+ "date:(<= #{sprintf "%012d", realdate.begin.to_i})"
+ else
+ Redwood::log "chronic: translated #{field}:#{datestr} to #{realdate}"
+ "date:(<= #{sprintf "%012d", realdate.end.to_i}) date:(>= #{sprintf "%012d", realdate.begin.to_i})"
+ end
+ else
+ BufferManager.flash "Can't understand date #{datestr.inspect}!"
+ chronic_failure = true
+ end
+ end
+ subs = nil if chronic_failure
+ end
+
+ Redwood::log "translated #{norms.inspect} to #{subs.inspect}" unless subs == norms
+ if subs
+ [@qparser.parse(subs), extraopts]
+ else
+ nil
+ end
+ end
+
def build_query opts
query = Ferret::Search::BooleanQuery.new
query.add_query opts[:qobj], :must if opts[:qobj]
end
query.add_query Ferret::Search::TermQuery.new("label", "spam"), :must_not unless opts[:load_spam] || labels.include?(:spam)
- query.add_query Ferret::Search::TermQuery.new("label", "killed"), :must_not unless opts[:load_killed] || labels.include?(:killed)
+ query.add_query Ferret::Search::TermQuery.new("label", "deleted"), :must_not unless opts[:load_deleted] || labels.include?(:deleted)
+ query.add_query Ferret::Search::TermQuery.new("label", "killed"), :must_not if opts[:skip_killed]
query
end
- def load_sources fn=Redwood::SOURCE_FN
- @sources = Hash[*(Redwood::load_yaml_obj(fn) || []).map { |s| [s.id, s] }.flatten]
- @sources_dirty = false
- end
-
def save_sources fn=Redwood::SOURCE_FN
if @sources_dirty || @sources.any? { |id, s| s.dirty? }
bakfn = fn + ".bak"
if File.exists? fn
File.chmod 0600, fn
- FileUtils.mv fn, bakfn, :force => true unless File.exists?(bakfn) && File.size(bakfn) > File.size(fn)
+ FileUtils.mv fn, bakfn, :force => true unless File.exists?(bakfn) && File.size(fn) == 0
end
- Redwood::save_yaml_obj @sources.values, fn
+ Redwood::save_yaml_obj sources.sort_by { |s| s.id.to_i }, fn, true
File.chmod 0600, fn
end
@sources_dirty = false